From 4bfd864f10b68b71482b35c818559068ef8d5797 Mon Sep 17 00:00:00 2001 From: Thomas Voss Date: Wed, 27 Nov 2024 20:54:24 +0100 Subject: doc: Add RFC documents --- doc/rfc/rfc3808.txt | 787 ++++++++++++++++++++++++++++++++++++++++++++++++++++ 1 file changed, 787 insertions(+) create mode 100644 doc/rfc/rfc3808.txt (limited to 'doc/rfc/rfc3808.txt') diff --git a/doc/rfc/rfc3808.txt b/doc/rfc/rfc3808.txt new file mode 100644 index 0000000..bca6823 --- /dev/null +++ b/doc/rfc/rfc3808.txt @@ -0,0 +1,787 @@ + + + + + + +Network Working Group I. McDonald +Request for Comments: 3808 High North +Category: Informational June 2004 + + + IANA Charset MIB + +Status of this Memo + + This memo provides information for the Internet community. It does + not specify an Internet standard of any kind. Distribution of this + memo is unlimited. + +Copyright Notice + + Copyright (C) The Internet Society (2004). + +Abstract + + This memo defines a portion of the Management Information Base (MIB) + for use with network management protocols in the Internet community. + This IANA Charset MIB is now an IANA registry. In particular, a + single textual convention 'IANACharset' is defined that may be used + to specify charset labels in MIB objects. 'IANACharset' was + extracted from Printer MIB v2 (RFC 3805). 'IANACharset' was + originally defined (and mis-named) as 'CodedCharSet' in Printer MIB + v1 (RFC 1759). A tool has been written in C, that may be used by + IANA to regenerate this IANA Charset MIB, when future charsets are + registered in accordance with the IANA Charset Registration + Procedures (RFC 2978). + +Table of Contents + + 1. Introduction. . . . . . . . . . . . . . . . . . . . . . . . . 2 + 1.1. Conformance Terminology . . . . . . . . . . . . . . . . 2 + 1.2. Charset Terminology . . . . . . . . . . . . . . . . . . 2 + 2. The Internet-Standard Management Framework. . . . . . . . . . 2 + 3. Generation of IANA Charset MIB. . . . . . . . . . . . . . . . 3 + 4. Definition of IANA Charset MIB. . . . . . . . . . . . . . . . 3 + 5. IANA Considerations . . . . . . . . . . . . . . . . . . . . . 10 + 6. Internationalization Considerations . . . . . . . . . . . . . 10 + 7. Security Considerations . . . . . . . . . . . . . . . . . . . 11 + 8. Acknowledgements. . . . . . . . . . . . . . . . . . . . . . . 11 + 9. References. . . . . . . . . . . . . . . . . . . . . . . . . . 11 + 9.1. Normative References. . . . . . . . . . . . . . . . . . 11 + 9.2. Informative References. . . . . . . . . . . . . . . . . 12 + 10. Authors' Addresses. . . . . . . . . . . . . . . . . . . . . . 13 + 11. Full Copyright Statement. . . . . . . . . . . . . . . . . . . 14 + + + +McDonald Informational [Page 1] + +RFC 3808 IANA Charset MIB June 2004 + + +1. Introduction + + This IANA Charset MIB [CHARMIB] module defines the single textual + convention 'IANACharset'. Once adopted, all future versions of the + IANA Charset MIB [CHARMIB] may be machine-generated whenever the IANA + Charset Registry [CHARSET] is updated by IANA staff according to the + procedures defined in [RFC2978], using the utility [CHARGEN] + described in section 3 of this document or any other machine- + generation method. + + It is strongly recommended that future updates to the IANA Charset + MIB [CHARMIB] be machine-generated (rather than hand-edited) to avoid + asynchrony between the IANA Charset Registry [CHARSET] and the IANA + Charset MIB [CHARMIB]. + + Note: Questions and comments on this IANA Charset MIB [CHARMIB] + should be sent to the editor (imcdonald@sharplabs.com) and IANA + (iana@iana.org) with a copy to the IETF Charsets mailing list (ietf- + charset@iana.org). + +1.1. Conformance Terminology + + The key words "MUST", "MUST NOT", "REQUIRED", "SHALL", "SHALL NOT", + "SHOULD", "SHOULD NOT", "RECOMMENDED", "MAY", and "OPTIONAL" in this + document are to be interpreted as described in BCP 14, RFC 2119 + [RFC2119]. + +1.2. Charset Terminology + + The following terms are used in this specification, exactly as + defined in section 1 'Definitions and Notation' of the IANA Charset + Registration Procedures [RFC2978]: "character", "charset", "coded + character set (CCS)", and "character encoding scheme (CES)". + +2. The Internet-Standard Management Framework + + For a detailed overview of the documents that describe the current + Internet-Standard Management Framework, please refer to section 7 of + RFC 3410 [RFC3410]. + + Managed objects are accessed via a virtual information store, termed + the Management Information Base or MIB. MIB objects are generally + accessed through the Simple Network Management Protocol (SNMP). + Objects in the MIB are defined using the mechanisms defined in the + Structure of Management Information (SMI). This memo specifies a MIB + module that is compliant to the SMIv2, which is described in STD 58, + RFC 2578 [RFC2578], STD 58, RFC 2579 [RFC2579], and STD 58, RFC 2580 + [RFC2580]. + + + +McDonald Informational [Page 2] + +RFC 3808 IANA Charset MIB June 2004 + + +3. Generation of IANA Charset MIB + + Intellectual Property: The C language utility 'ianachar.c' [CHARGEN] + and the IANA Charset MIB template file [CHARTEMP] are hereby donated + by the author (Ira McDonald) to IANA, in perpetuity, free of license + or any other restraint. + + The [CHARGEN] utility may be used to generate an updated version of + the 'IANACharset' textual convention by reading and parsing the + (currently plaintext) IANA Charset Registry [CHARSET]. + + This utility parses each charset registration, finding (in order): + + 1) The 'Name' field (which is saved for a fallback - see below); + + 2) The 'MIBenum' field (which contains the IANA-assigned positive + decimal enum value); and + + 3) The (usually present) 'Alias' field that begins with 'cs' (that + contains the IANA-assigned enum label). If an 'Alias' field is + not found, the utility constructs one from the 'Name' field by: + + - Beginning the enum label with a lowercase 'cs' prefix; + + - Copying _only_ alpha/numeric characters from the 'Name' field + to the enum label (ignoring punctuation, whitespace, etc.). + +4. Definition of IANA Charset MIB + +IANA-CHARSET-MIB DEFINITIONS ::= BEGIN +-- http://www.iana.org/assignments/ianacharset-mib + +IMPORTS + MODULE-IDENTITY, + mib-2 + FROM SNMPv2-SMI -- [RFC2578] + TEXTUAL-CONVENTION + FROM SNMPv2-TC; -- [RFC2579] + +ianaCharsetMIB MODULE-IDENTITY + LAST-UPDATED "200406080000Z" + ORGANIZATION "IANA" + CONTACT-INFO " Internet Assigned Numbers Authority + + Postal: ICANN + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292 + + + + +McDonald Informational [Page 3] + +RFC 3808 IANA Charset MIB June 2004 + + + Tel: +1 310 823 9358 + E-Mail: iana@iana.org" + + DESCRIPTION "This MIB module defines the IANACharset + TEXTUAL-CONVENTION. The IANACharset TC is used to + specify the encoding of string objects defined in + a MIB. + + Each version of this MIB will be released based on + the IANA Charset Registry file (see RFC 2978) at + http://www.iana.org/assignments/character-sets. + + Note: The IANACharset TC, originally defined in + RFC 1759, was inaccurately named CodedCharSet. + + Note: Best practice is to define new MIB string + objects with invariant UTF-8 (RFC 3629) syntax + using the SnmpAdminString TC (defined in RFC 3411) + in accordance with IETF Policy on Character Sets and + Languages (RFC 2277). + + Copyright (C) The Internet Society (2004). The + initial version of this MIB module was published + in RFC 3808; for full legal notices see the RFC + itself. Supplementary information may be + available on + http://www.ietf.org/copyrights/ianamib.html." + + -- revision history + + REVISION "200406080000Z" + DESCRIPTION "Original version transferred from Printer MIB, + generated from the IANA maintained assignments + http://www.iana.org/assignments/character-sets." + + ::= { mib-2 106 } + +IANACharset ::= TEXTUAL-CONVENTION + STATUS current + DESCRIPTION + "Specifies an IANA registered 'charset' - coded character set + (CCS) plus optional character encoding scheme (CES) - terms + defined in 'IANA Charset Registration Procedures' (RFC 2978). + + Objects of this syntax are used to specify the encoding for + string objects defined in one or more MIBs. For example, the + prtLocalizationCharacterSet, prtInterpreterDefaultCharSetIn, and + prtInterpreterDefaultCharSetOut objects defined in Printer MIB. + + + +McDonald Informational [Page 4] + +RFC 3808 IANA Charset MIB June 2004 + + + The current list of 'charset' names and enumerated values + is contained in the IANA Character Set Registry at: + + http://www.iana.org/assignments/character-sets + + Enum names are derived from the IANA Charset Registry 'Alias' + fields that begin with 'cs' (for character set). + Enum values are derived from the parallel 'MIBenum' fields." + SYNTAX INTEGER { + other(1), -- used if the designated + -- character set is not currently + -- registered by IANA + unknown(2), -- used as a default value + csASCII(3), + csISOLatin1(4), + csISOLatin2(5), + csISOLatin3(6), + csISOLatin4(7), + csISOLatinCyrillic(8), + csISOLatinArabic(9), + csISOLatinGreek(10), + csISOLatinHebrew(11), + csISOLatin5(12), + csISOLatin6(13), + csISOTextComm(14), + csHalfWidthKatakana(15), + csJISEncoding(16), + csShiftJIS(17), + csEUCPkdFmtJapanese(18), + csEUCFixWidJapanese(19), + csISO4UnitedKingdom(20), + csISO11SwedishForNames(21), + csISO15Italian(22), + csISO17Spanish(23), + csISO21German(24), + csISO60DanishNorwegian(25), + csISO69French(26), + csISO10646UTF1(27), + csISO646basic1983(28), + csINVARIANT(29), + csISO2IntlRefVersion(30), + csNATSSEFI(31), + csNATSSEFIADD(32), + csNATSDANO(33), + csNATSDANOADD(34), + csISO10Swedish(35), + csKSC56011987(36), + csISO2022KR(37), + + + +McDonald Informational [Page 5] + +RFC 3808 IANA Charset MIB June 2004 + + + csEUCKR(38), + csISO2022JP(39), + csISO2022JP2(40), + csISO13JISC6220jp(41), + csISO14JISC6220ro(42), + csISO16Portuguese(43), + csISO18Greek7Old(44), + csISO19LatinGreek(45), + csISO25French(46), + csISO27LatinGreek1(47), + csISO5427Cyrillic(48), + csISO42JISC62261978(49), + csISO47BSViewdata(50), + csISO49INIS(51), + csISO50INIS8(52), + csISO51INISCyrillic(53), + csISO54271981(54), + csISO5428Greek(55), + csISO57GB1988(56), + csISO58GB231280(57), + csISO61Norwegian2(58), + csISO70VideotexSupp1(59), + csISO84Portuguese2(60), + csISO85Spanish2(61), + csISO86Hungarian(62), + csISO87JISX0208(63), + csISO88Greek7(64), + csISO89ASMO449(65), + csISO90(66), + csISO91JISC62291984a(67), + csISO92JISC62991984b(68), + csISO93JIS62291984badd(69), + csISO94JIS62291984hand(70), + csISO95JIS62291984handadd(71), + csISO96JISC62291984kana(72), + csISO2033(73), + csISO99NAPLPS(74), + csISO102T617bit(75), + csISO103T618bit(76), + csISO111ECMACyrillic(77), + csa71(78), + csa72(79), + csISO123CSAZ24341985gr(80), + csISO88596E(81), + csISO88596I(82), + csISO128T101G2(83), + csISO88598E(84), + csISO88598I(85), + + + +McDonald Informational [Page 6] + +RFC 3808 IANA Charset MIB June 2004 + + + csISO139CSN369103(86), + csISO141JUSIB1002(87), + csISO143IECP271(88), + csISO146Serbian(89), + csISO147Macedonian(90), + csISO150(91), + csISO151Cuba(92), + csISO6937Add(93), + csISO153GOST1976874(94), + csISO8859Supp(95), + csISO10367Box(96), + csISO158Lap(97), + csISO159JISX02121990(98), + csISO646Danish(99), + csUSDK(100), + csDKUS(101), + csKSC5636(102), + csUnicode11UTF7(103), + csISO2022CN(104), + csISO2022CNEXT(105), + csUTF8(106), + csISO885913(109), + csISO885914(110), + csISO885915(111), + csISO885916(112), + csGBK(113), + csGB18030(114), + csOSDEBCDICDF0415(115), + csOSDEBCDICDF03IRV(116), + csOSDEBCDICDF041(117), + csUnicode(1000), + csUCS4(1001), + csUnicodeASCII(1002), + csUnicodeLatin1(1003), + csUnicodeIBM1261(1005), + csUnicodeIBM1268(1006), + csUnicodeIBM1276(1007), + csUnicodeIBM1264(1008), + csUnicodeIBM1265(1009), + csUnicode11(1010), + csSCSU(1011), + csUTF7(1012), + csUTF16BE(1013), + csUTF16LE(1014), + csUTF16(1015), + csCESU8(1016), + csUTF32(1017), + csUTF32BE(1018), + + + +McDonald Informational [Page 7] + +RFC 3808 IANA Charset MIB June 2004 + + + csUTF32LE(1019), + csBOCU1(1020), + csWindows30Latin1(2000), + csWindows31Latin1(2001), + csWindows31Latin2(2002), + csWindows31Latin5(2003), + csHPRoman8(2004), + csAdobeStandardEncoding(2005), + csVenturaUS(2006), + csVenturaInternational(2007), + csDECMCS(2008), + csPC850Multilingual(2009), + csPCp852(2010), + csPC8CodePage437(2011), + csPC8DanishNorwegian(2012), + csPC862LatinHebrew(2013), + csPC8Turkish(2014), + csIBMSymbols(2015), + csIBMThai(2016), + csHPLegal(2017), + csHPPiFont(2018), + csHPMath8(2019), + csHPPSMath(2020), + csHPDesktop(2021), + csVenturaMath(2022), + csMicrosoftPublishing(2023), + csWindows31J(2024), + csGB2312(2025), + csBig5(2026), + csMacintosh(2027), + csIBM037(2028), + csIBM038(2029), + csIBM273(2030), + csIBM274(2031), + csIBM275(2032), + csIBM277(2033), + csIBM278(2034), + csIBM280(2035), + csIBM281(2036), + csIBM284(2037), + csIBM285(2038), + csIBM290(2039), + csIBM297(2040), + csIBM420(2041), + csIBM423(2042), + csIBM424(2043), + csIBM500(2044), + csIBM851(2045), + + + +McDonald Informational [Page 8] + +RFC 3808 IANA Charset MIB June 2004 + + + csIBM855(2046), + csIBM857(2047), + csIBM860(2048), + csIBM861(2049), + csIBM863(2050), + csIBM864(2051), + csIBM865(2052), + csIBM868(2053), + csIBM869(2054), + csIBM870(2055), + csIBM871(2056), + csIBM880(2057), + csIBM891(2058), + csIBM903(2059), + csIBBM904(2060), + csIBM905(2061), + csIBM918(2062), + csIBM1026(2063), + csIBMEBCDICATDE(2064), + csEBCDICATDEA(2065), + csEBCDICCAFR(2066), + csEBCDICDKNO(2067), + csEBCDICDKNOA(2068), + csEBCDICFISE(2069), + csEBCDICFISEA(2070), + csEBCDICFR(2071), + csEBCDICIT(2072), + csEBCDICPT(2073), + csEBCDICES(2074), + csEBCDICESA(2075), + csEBCDICESS(2076), + csEBCDICUK(2077), + csEBCDICUS(2078), + csUnknown8BiT(2079), + csMnemonic(2080), + csMnem(2081), + csVISCII(2082), + csVIQR(2083), + csKOI8R(2084), + csHZGB2312(2085), + csIBM866(2086), + csPC775Baltic(2087), + csKOI8U(2088), + csIBM00858(2089), + csIBM00924(2090), + csIBM01140(2091), + csIBM01141(2092), + csIBM01142(2093), + + + +McDonald Informational [Page 9] + +RFC 3808 IANA Charset MIB June 2004 + + + csIBM01143(2094), + csIBM01144(2095), + csIBM01145(2096), + csIBM01146(2097), + csIBM01147(2098), + csIBM01148(2099), + csIBM01149(2100), + csBig5HKSCS(2101), + csIBM1047(2102), + csPTCP154(2103), + csAmiga1251(2104), + csKOI7switched(2105), + cswindows1250(2250), + cswindows1251(2251), + cswindows1252(2252), + cswindows1253(2253), + cswindows1254(2254), + cswindows1255(2255), + cswindows1256(2256), + cswindows1257(2257), + cswindows1258(2258), + csTIS620(2259), + reserved(3000) + } +END + +5. IANA Considerations + + IANA has assigned a base arc in the 'mgmt' (standards track) OID tree + for the 'ianaCharset' MODULE-IDENTITY defined in the IANA Charset MIB + [CHARMIB]. + + Whenever any 'charset' is added to the IANA Charset Registry + [CHARSET], a new version of the IANA Charset MIB [CHARMIB] may be + machine-generated using the C language utility [CHARGEN], described + in section 3 of this document or some other utility. + +6. Internationalization Considerations + + The IANA Charset MIB [CHARMIB] defines the 'IANACharset' textual + convention that may be used in a given MIB module to supply explicit + character set labels for one or more text string objects defined in + that MIB module. + + For example, the Printer MIB [RFC1759] defines the three character + set label objects 'prtLocalizationCharacterSet' (for description and + console strings), 'prtInterpreterDefaultCharSetIn' (for received + + + + +McDonald Informational [Page 10] + +RFC 3808 IANA Charset MIB June 2004 + + + print job input data), and 'prtIntpreterDefaultCharSetOut' (for + processed print job output data). + + The IANA Charset MIB [CHARMIB] supports implementation of the best + practices specified in "IETF Policy on Character Sets and Languages" + [RFC2277]. + + Note: The use of the 'SnmpAdminString' textual convention defined in + [RFC3411], which has a fixed character set of UTF-8 [RFC3629], is + STRONGLY RECOMMENDED in defining new MIB modules. The IANA Charset + MIB [CHARMIB] supports locale-specific MIB objects with variable + character sets. + +7. Security Considerations + + This MIB module does not define any management objects. Instead, it + defines a (set of) textual convention(s) which may be used by other + MIB modules to define management objects. + + Meaningful security considerations can only be written in the MIB + modules that define management objects. Therefore, this document has + no impact on the security of the Internet. + +8. Acknowledgements + + The editor would like to thank: Bert Wijnen (Lucent) for his + original suggestion that the 'IANACharset' textual convention should + be extracted from Printer MIB v2 [RFC3805]; Ron Bergman (Hitachi + Printing Solutions) and Harry Lewis (IBM) for their many years of + effort as editors of Printer MIB v2 [RFC3805]. + +9. References + +9.1. Normative References + + [RFC2119] Bradner, S., "Key words for use in RFCs to Indicate + Requirement Levels", BCP 14, RFC 2119, March 1997. + + [RFC2277] Alvestrand, H., "IETF Policy on Character Sets and + Languages", RFC 2277, January 1998. + + [RFC2578] McCloghrie, K., Perkins, D., and J. Schoenwaelder, + "Structure of Management Information Version 2 (SMIv2)", + STD 58, RFC 2578, April 1999. + + [RFC2579] McCloghrie, K., Perkins, D., and J. Schoenwaelder, + "Textual Conventions for SMIv2", STD 58, RFC 2579, April + 1999. + + + +McDonald Informational [Page 11] + +RFC 3808 IANA Charset MIB June 2004 + + + [RFC2580] McCloghrie, K., Perkins, D., and J. Schoenwaelder, + "Conformance Statements for SMIv2", STD 58, RFC 2580, + April 1999. + + [RFC2978] Freed, N. and J. Postel, "IANA Charset Registration + Procedures", BCP 19, RFC 2978, October 2000. + + [RFC3411] Harrington, D., Presuhn, R., and B. Wijnen, "An + Architecture for Describing SNMP Network Management + Frameworks", STD 62, RFC 3411, December 2002. + + [RFC3629] Yergeau, F., "UTF-8, a transformation format of ISO + 10646", RFC 3629, November 2003. + +9.2. Informative References + + [CHARGEN] IANA Charset MIB Generation Utility (archived at): + ftp://www.pwg.org/pub/pwg/pmp/tools/ianachar.c + + [CHARMIB] IANA Charset MIB (in the future, to be archived at): + http://www.iana.org/assignments/ianacharset-mib + + [CHARSET] IANA Charset Registry (archived at): + http://www.iana.org/assignments/character-sets + + [CHARTEMP] IANA Charset MIB template file (archived at): + ftp://www.pwg.org/pub/pwg/pmp/tools/ianachar.dat + + [RFC1759] Smith, R., Wright, F., Hastings, T., Zilles, S., and J. + Gyllenskog. "Printer MIB", RFC 1759, March 1995. + + [RFC3805] Bergman, R., Lewis, H., and I. McDonald, "Printer MIB + v2", RFC 3805, June 2004. + + [RFC3410] Case, J., Mundy, P., Partain, D., and B. Stewart, + "Introduction and Applicability Statements for + Internet-Standard Network Management Framework", RFC + 3410, December 2002. + + + + + + + + + + + + + +McDonald Informational [Page 12] + +RFC 3808 IANA Charset MIB June 2004 + + +10. Authors' Addresses + + Ira McDonald + High North Inc + 221 Ridge Ave + Grand Marais, MI 49839 + USA + + Phone: +1 906 494 2434 + EMail: imcdonald@sharplabs.com + + + Internet Assigned Numbers Authority (IANA) + ICANN + 4676 Admiralty Way, Suite 330 + Marina del Rey, CA 90292 + USA + + Phone: +1 310 823 9358 + EMail: iana@iana.org + + Note: Questions and comments on this IANA Charset MIB [CHARMIB] + should be sent to the editor (imcdonald@sharplabs.com) and IANA + (iana@iana.org) with a copy to the IETF Charsets mailing list + (ietf-charset@iana.org). + + + + + + + + + + + + + + + + + + + + + + + + + + +McDonald Informational [Page 13] + +RFC 3808 IANA Charset MIB June 2004 + + +11. Full Copyright Statement + + Copyright (C) The Internet Society (2004). This document is subject + to the rights, licenses and restrictions contained in BCP 78, and + except as set forth therein, the authors retain all their rights. + + This document and the information contained herein are provided on an + "AS IS" basis and THE CONTRIBUTOR, THE ORGANIZATION HE/SHE REPRESENTS + OR IS SPONSORED BY (IF ANY), THE INTERNET SOCIETY AND THE INTERNET + ENGINEERING TASK FORCE DISCLAIM ALL WARRANTIES, EXPRESS OR IMPLIED, + INCLUDING BUT NOT LIMITED TO ANY WARRANTY THAT THE USE OF THE + INFORMATION HEREIN WILL NOT INFRINGE ANY RIGHTS OR ANY IMPLIED + WARRANTIES OF MERCHANTABILITY OR FITNESS FOR A PARTICULAR PURPOSE. + +Intellectual Property + + The IETF takes no position regarding the validity or scope of any + Intellectual Property Rights or other rights that might be claimed to + pertain to the implementation or use of the technology described in + this document or the extent to which any license under such rights + might or might not be available; nor does it represent that it has + made any independent effort to identify any such rights. Information + on the procedures with respect to rights in RFC documents can be + found in BCP 78 and BCP 79. + + Copies of IPR disclosures made to the IETF Secretariat and any + assurances of licenses to be made available, or the result of an + attempt made to obtain a general license or permission for the use of + such proprietary rights by implementers or users of this + specification can be obtained from the IETF on-line IPR repository at + http://www.ietf.org/ipr. + + The IETF invites any interested party to bring to its attention any + copyrights, patents or patent applications, or other proprietary + rights that may cover technology that may be required to implement + this standard. Please address the information to the IETF at ietf- + ipr@ietf.org. + +Acknowledgement + + Funding for the RFC Editor function is currently provided by the + Internet Society. + + + + + + + + + +McDonald Informational [Page 14] + -- cgit v1.2.3