summaryrefslogtreecommitdiff
path: root/doc/rfc/rfc3808.txt
diff options
context:
space:
mode:
authorThomas Voss <mail@thomasvoss.com> 2024-11-27 20:54:24 +0100
committerThomas Voss <mail@thomasvoss.com> 2024-11-27 20:54:24 +0100
commit4bfd864f10b68b71482b35c818559068ef8d5797 (patch)
treee3989f47a7994642eb325063d46e8f08ffa681dc /doc/rfc/rfc3808.txt
parentea76e11061bda059ae9f9ad130a9895cc85607db (diff)
doc: Add RFC documents
Diffstat (limited to 'doc/rfc/rfc3808.txt')
-rw-r--r--doc/rfc/rfc3808.txt787
1 files changed, 787 insertions, 0 deletions
diff --git a/doc/rfc/rfc3808.txt b/doc/rfc/rfc3808.txt
new file mode 100644
index 0000000..bca6823
--- /dev/null
+++ b/doc/rfc/rfc3808.txt
@@ -0,0 +1,787 @@
+
+
+
+
+
+
+Network Working Group I. McDonald
+Request for Comments: 3808 High North
+Category: Informational June 2004
+
+
+ IANA Charset MIB
+
+Status of this Memo
+
+ This memo provides information for the Internet community. It does
+ not specify an Internet standard of any kind. Distribution of this
+ memo is unlimited.
+
+Copyright Notice
+
+ Copyright (C) The Internet Society (2004).
+
+Abstract
+
+ This memo defines a portion of the Management Information Base (MIB)
+ for use with network management protocols in the Internet community.
+ This IANA Charset MIB is now an IANA registry. In particular, a
+ single textual convention 'IANACharset' is defined that may be used
+ to specify charset labels in MIB objects. 'IANACharset' was
+ extracted from Printer MIB v2 (RFC 3805). 'IANACharset' was
+ originally defined (and mis-named) as 'CodedCharSet' in Printer MIB
+ v1 (RFC 1759). A tool has been written in C, that may be used by
+ IANA to regenerate this IANA Charset MIB, when future charsets are
+ registered in accordance with the IANA Charset Registration
+ Procedures (RFC 2978).
+
+Table of Contents
+
+ 1. Introduction. . . . . . . . . . . . . . . . . . . . . . . . . 2
+ 1.1. Conformance Terminology . . . . . . . . . . . . . . . . 2
+ 1.2. Charset Terminology . . . . . . . . . . . . . . . . . . 2
+ 2. The Internet-Standard Management Framework. . . . . . . . . . 2
+ 3. Generation of IANA Charset MIB. . . . . . . . . . . . . . . . 3
+ 4. Definition of IANA Charset MIB. . . . . . . . . . . . . . . . 3
+ 5. IANA Considerations . . . . . . . . . . . . . . . . . . . . . 10
+ 6. Internationalization Considerations . . . . . . . . . . . . . 10
+ 7. Security Considerations . . . . . . . . . . . . . . . . . . . 11
+ 8. Acknowledgements. . . . . . . . . . . . . . . . . . . . . . . 11
+ 9. References. . . . . . . . . . . . . . . . . . . . . . . . . . 11
+ 9.1. Normative References. . . . . . . . . . . . . . . . . . 11
+ 9.2. Informative References. . . . . . . . . . . . . . . . . 12
+ 10. Authors' Addresses. . . . . . . . . . . . . . . . . . . . . . 13
+ 11. Full Copyright Statement. . . . . . . . . . . . . . . . . . . 14
+
+
+
+McDonald Informational [Page 1]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+1. Introduction
+
+ This IANA Charset MIB [CHARMIB] module defines the single textual
+ convention 'IANACharset'. Once adopted, all future versions of the
+ IANA Charset MIB [CHARMIB] may be machine-generated whenever the IANA
+ Charset Registry [CHARSET] is updated by IANA staff according to the
+ procedures defined in [RFC2978], using the utility [CHARGEN]
+ described in section 3 of this document or any other machine-
+ generation method.
+
+ It is strongly recommended that future updates to the IANA Charset
+ MIB [CHARMIB] be machine-generated (rather than hand-edited) to avoid
+ asynchrony between the IANA Charset Registry [CHARSET] and the IANA
+ Charset MIB [CHARMIB].
+
+ Note: Questions and comments on this IANA Charset MIB [CHARMIB]
+ should be sent to the editor (imcdonald@sharplabs.com) and IANA
+ (iana@iana.org) with a copy to the IETF Charsets mailing list (ietf-
+ charset@iana.org).
+
+1.1. Conformance Terminology
+
+ The key words "MUST", "MUST NOT", "REQUIRED", "SHALL", "SHALL NOT",
+ "SHOULD", "SHOULD NOT", "RECOMMENDED", "MAY", and "OPTIONAL" in this
+ document are to be interpreted as described in BCP 14, RFC 2119
+ [RFC2119].
+
+1.2. Charset Terminology
+
+ The following terms are used in this specification, exactly as
+ defined in section 1 'Definitions and Notation' of the IANA Charset
+ Registration Procedures [RFC2978]: "character", "charset", "coded
+ character set (CCS)", and "character encoding scheme (CES)".
+
+2. The Internet-Standard Management Framework
+
+ For a detailed overview of the documents that describe the current
+ Internet-Standard Management Framework, please refer to section 7 of
+ RFC 3410 [RFC3410].
+
+ Managed objects are accessed via a virtual information store, termed
+ the Management Information Base or MIB. MIB objects are generally
+ accessed through the Simple Network Management Protocol (SNMP).
+ Objects in the MIB are defined using the mechanisms defined in the
+ Structure of Management Information (SMI). This memo specifies a MIB
+ module that is compliant to the SMIv2, which is described in STD 58,
+ RFC 2578 [RFC2578], STD 58, RFC 2579 [RFC2579], and STD 58, RFC 2580
+ [RFC2580].
+
+
+
+McDonald Informational [Page 2]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+3. Generation of IANA Charset MIB
+
+ Intellectual Property: The C language utility 'ianachar.c' [CHARGEN]
+ and the IANA Charset MIB template file [CHARTEMP] are hereby donated
+ by the author (Ira McDonald) to IANA, in perpetuity, free of license
+ or any other restraint.
+
+ The [CHARGEN] utility may be used to generate an updated version of
+ the 'IANACharset' textual convention by reading and parsing the
+ (currently plaintext) IANA Charset Registry [CHARSET].
+
+ This utility parses each charset registration, finding (in order):
+
+ 1) The 'Name' field (which is saved for a fallback - see below);
+
+ 2) The 'MIBenum' field (which contains the IANA-assigned positive
+ decimal enum value); and
+
+ 3) The (usually present) 'Alias' field that begins with 'cs' (that
+ contains the IANA-assigned enum label). If an 'Alias' field is
+ not found, the utility constructs one from the 'Name' field by:
+
+ - Beginning the enum label with a lowercase 'cs' prefix;
+
+ - Copying _only_ alpha/numeric characters from the 'Name' field
+ to the enum label (ignoring punctuation, whitespace, etc.).
+
+4. Definition of IANA Charset MIB
+
+IANA-CHARSET-MIB DEFINITIONS ::= BEGIN
+-- http://www.iana.org/assignments/ianacharset-mib
+
+IMPORTS
+ MODULE-IDENTITY,
+ mib-2
+ FROM SNMPv2-SMI -- [RFC2578]
+ TEXTUAL-CONVENTION
+ FROM SNMPv2-TC; -- [RFC2579]
+
+ianaCharsetMIB MODULE-IDENTITY
+ LAST-UPDATED "200406080000Z"
+ ORGANIZATION "IANA"
+ CONTACT-INFO " Internet Assigned Numbers Authority
+
+ Postal: ICANN
+ 4676 Admiralty Way, Suite 330
+ Marina del Rey, CA 90292
+
+
+
+
+McDonald Informational [Page 3]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ Tel: +1 310 823 9358
+ E-Mail: iana@iana.org"
+
+ DESCRIPTION "This MIB module defines the IANACharset
+ TEXTUAL-CONVENTION. The IANACharset TC is used to
+ specify the encoding of string objects defined in
+ a MIB.
+
+ Each version of this MIB will be released based on
+ the IANA Charset Registry file (see RFC 2978) at
+ http://www.iana.org/assignments/character-sets.
+
+ Note: The IANACharset TC, originally defined in
+ RFC 1759, was inaccurately named CodedCharSet.
+
+ Note: Best practice is to define new MIB string
+ objects with invariant UTF-8 (RFC 3629) syntax
+ using the SnmpAdminString TC (defined in RFC 3411)
+ in accordance with IETF Policy on Character Sets and
+ Languages (RFC 2277).
+
+ Copyright (C) The Internet Society (2004). The
+ initial version of this MIB module was published
+ in RFC 3808; for full legal notices see the RFC
+ itself. Supplementary information may be
+ available on
+ http://www.ietf.org/copyrights/ianamib.html."
+
+ -- revision history
+
+ REVISION "200406080000Z"
+ DESCRIPTION "Original version transferred from Printer MIB,
+ generated from the IANA maintained assignments
+ http://www.iana.org/assignments/character-sets."
+
+ ::= { mib-2 106 }
+
+IANACharset ::= TEXTUAL-CONVENTION
+ STATUS current
+ DESCRIPTION
+ "Specifies an IANA registered 'charset' - coded character set
+ (CCS) plus optional character encoding scheme (CES) - terms
+ defined in 'IANA Charset Registration Procedures' (RFC 2978).
+
+ Objects of this syntax are used to specify the encoding for
+ string objects defined in one or more MIBs. For example, the
+ prtLocalizationCharacterSet, prtInterpreterDefaultCharSetIn, and
+ prtInterpreterDefaultCharSetOut objects defined in Printer MIB.
+
+
+
+McDonald Informational [Page 4]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ The current list of 'charset' names and enumerated values
+ is contained in the IANA Character Set Registry at:
+
+ http://www.iana.org/assignments/character-sets
+
+ Enum names are derived from the IANA Charset Registry 'Alias'
+ fields that begin with 'cs' (for character set).
+ Enum values are derived from the parallel 'MIBenum' fields."
+ SYNTAX INTEGER {
+ other(1), -- used if the designated
+ -- character set is not currently
+ -- registered by IANA
+ unknown(2), -- used as a default value
+ csASCII(3),
+ csISOLatin1(4),
+ csISOLatin2(5),
+ csISOLatin3(6),
+ csISOLatin4(7),
+ csISOLatinCyrillic(8),
+ csISOLatinArabic(9),
+ csISOLatinGreek(10),
+ csISOLatinHebrew(11),
+ csISOLatin5(12),
+ csISOLatin6(13),
+ csISOTextComm(14),
+ csHalfWidthKatakana(15),
+ csJISEncoding(16),
+ csShiftJIS(17),
+ csEUCPkdFmtJapanese(18),
+ csEUCFixWidJapanese(19),
+ csISO4UnitedKingdom(20),
+ csISO11SwedishForNames(21),
+ csISO15Italian(22),
+ csISO17Spanish(23),
+ csISO21German(24),
+ csISO60DanishNorwegian(25),
+ csISO69French(26),
+ csISO10646UTF1(27),
+ csISO646basic1983(28),
+ csINVARIANT(29),
+ csISO2IntlRefVersion(30),
+ csNATSSEFI(31),
+ csNATSSEFIADD(32),
+ csNATSDANO(33),
+ csNATSDANOADD(34),
+ csISO10Swedish(35),
+ csKSC56011987(36),
+ csISO2022KR(37),
+
+
+
+McDonald Informational [Page 5]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ csEUCKR(38),
+ csISO2022JP(39),
+ csISO2022JP2(40),
+ csISO13JISC6220jp(41),
+ csISO14JISC6220ro(42),
+ csISO16Portuguese(43),
+ csISO18Greek7Old(44),
+ csISO19LatinGreek(45),
+ csISO25French(46),
+ csISO27LatinGreek1(47),
+ csISO5427Cyrillic(48),
+ csISO42JISC62261978(49),
+ csISO47BSViewdata(50),
+ csISO49INIS(51),
+ csISO50INIS8(52),
+ csISO51INISCyrillic(53),
+ csISO54271981(54),
+ csISO5428Greek(55),
+ csISO57GB1988(56),
+ csISO58GB231280(57),
+ csISO61Norwegian2(58),
+ csISO70VideotexSupp1(59),
+ csISO84Portuguese2(60),
+ csISO85Spanish2(61),
+ csISO86Hungarian(62),
+ csISO87JISX0208(63),
+ csISO88Greek7(64),
+ csISO89ASMO449(65),
+ csISO90(66),
+ csISO91JISC62291984a(67),
+ csISO92JISC62991984b(68),
+ csISO93JIS62291984badd(69),
+ csISO94JIS62291984hand(70),
+ csISO95JIS62291984handadd(71),
+ csISO96JISC62291984kana(72),
+ csISO2033(73),
+ csISO99NAPLPS(74),
+ csISO102T617bit(75),
+ csISO103T618bit(76),
+ csISO111ECMACyrillic(77),
+ csa71(78),
+ csa72(79),
+ csISO123CSAZ24341985gr(80),
+ csISO88596E(81),
+ csISO88596I(82),
+ csISO128T101G2(83),
+ csISO88598E(84),
+ csISO88598I(85),
+
+
+
+McDonald Informational [Page 6]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ csISO139CSN369103(86),
+ csISO141JUSIB1002(87),
+ csISO143IECP271(88),
+ csISO146Serbian(89),
+ csISO147Macedonian(90),
+ csISO150(91),
+ csISO151Cuba(92),
+ csISO6937Add(93),
+ csISO153GOST1976874(94),
+ csISO8859Supp(95),
+ csISO10367Box(96),
+ csISO158Lap(97),
+ csISO159JISX02121990(98),
+ csISO646Danish(99),
+ csUSDK(100),
+ csDKUS(101),
+ csKSC5636(102),
+ csUnicode11UTF7(103),
+ csISO2022CN(104),
+ csISO2022CNEXT(105),
+ csUTF8(106),
+ csISO885913(109),
+ csISO885914(110),
+ csISO885915(111),
+ csISO885916(112),
+ csGBK(113),
+ csGB18030(114),
+ csOSDEBCDICDF0415(115),
+ csOSDEBCDICDF03IRV(116),
+ csOSDEBCDICDF041(117),
+ csUnicode(1000),
+ csUCS4(1001),
+ csUnicodeASCII(1002),
+ csUnicodeLatin1(1003),
+ csUnicodeIBM1261(1005),
+ csUnicodeIBM1268(1006),
+ csUnicodeIBM1276(1007),
+ csUnicodeIBM1264(1008),
+ csUnicodeIBM1265(1009),
+ csUnicode11(1010),
+ csSCSU(1011),
+ csUTF7(1012),
+ csUTF16BE(1013),
+ csUTF16LE(1014),
+ csUTF16(1015),
+ csCESU8(1016),
+ csUTF32(1017),
+ csUTF32BE(1018),
+
+
+
+McDonald Informational [Page 7]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ csUTF32LE(1019),
+ csBOCU1(1020),
+ csWindows30Latin1(2000),
+ csWindows31Latin1(2001),
+ csWindows31Latin2(2002),
+ csWindows31Latin5(2003),
+ csHPRoman8(2004),
+ csAdobeStandardEncoding(2005),
+ csVenturaUS(2006),
+ csVenturaInternational(2007),
+ csDECMCS(2008),
+ csPC850Multilingual(2009),
+ csPCp852(2010),
+ csPC8CodePage437(2011),
+ csPC8DanishNorwegian(2012),
+ csPC862LatinHebrew(2013),
+ csPC8Turkish(2014),
+ csIBMSymbols(2015),
+ csIBMThai(2016),
+ csHPLegal(2017),
+ csHPPiFont(2018),
+ csHPMath8(2019),
+ csHPPSMath(2020),
+ csHPDesktop(2021),
+ csVenturaMath(2022),
+ csMicrosoftPublishing(2023),
+ csWindows31J(2024),
+ csGB2312(2025),
+ csBig5(2026),
+ csMacintosh(2027),
+ csIBM037(2028),
+ csIBM038(2029),
+ csIBM273(2030),
+ csIBM274(2031),
+ csIBM275(2032),
+ csIBM277(2033),
+ csIBM278(2034),
+ csIBM280(2035),
+ csIBM281(2036),
+ csIBM284(2037),
+ csIBM285(2038),
+ csIBM290(2039),
+ csIBM297(2040),
+ csIBM420(2041),
+ csIBM423(2042),
+ csIBM424(2043),
+ csIBM500(2044),
+ csIBM851(2045),
+
+
+
+McDonald Informational [Page 8]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ csIBM855(2046),
+ csIBM857(2047),
+ csIBM860(2048),
+ csIBM861(2049),
+ csIBM863(2050),
+ csIBM864(2051),
+ csIBM865(2052),
+ csIBM868(2053),
+ csIBM869(2054),
+ csIBM870(2055),
+ csIBM871(2056),
+ csIBM880(2057),
+ csIBM891(2058),
+ csIBM903(2059),
+ csIBBM904(2060),
+ csIBM905(2061),
+ csIBM918(2062),
+ csIBM1026(2063),
+ csIBMEBCDICATDE(2064),
+ csEBCDICATDEA(2065),
+ csEBCDICCAFR(2066),
+ csEBCDICDKNO(2067),
+ csEBCDICDKNOA(2068),
+ csEBCDICFISE(2069),
+ csEBCDICFISEA(2070),
+ csEBCDICFR(2071),
+ csEBCDICIT(2072),
+ csEBCDICPT(2073),
+ csEBCDICES(2074),
+ csEBCDICESA(2075),
+ csEBCDICESS(2076),
+ csEBCDICUK(2077),
+ csEBCDICUS(2078),
+ csUnknown8BiT(2079),
+ csMnemonic(2080),
+ csMnem(2081),
+ csVISCII(2082),
+ csVIQR(2083),
+ csKOI8R(2084),
+ csHZGB2312(2085),
+ csIBM866(2086),
+ csPC775Baltic(2087),
+ csKOI8U(2088),
+ csIBM00858(2089),
+ csIBM00924(2090),
+ csIBM01140(2091),
+ csIBM01141(2092),
+ csIBM01142(2093),
+
+
+
+McDonald Informational [Page 9]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ csIBM01143(2094),
+ csIBM01144(2095),
+ csIBM01145(2096),
+ csIBM01146(2097),
+ csIBM01147(2098),
+ csIBM01148(2099),
+ csIBM01149(2100),
+ csBig5HKSCS(2101),
+ csIBM1047(2102),
+ csPTCP154(2103),
+ csAmiga1251(2104),
+ csKOI7switched(2105),
+ cswindows1250(2250),
+ cswindows1251(2251),
+ cswindows1252(2252),
+ cswindows1253(2253),
+ cswindows1254(2254),
+ cswindows1255(2255),
+ cswindows1256(2256),
+ cswindows1257(2257),
+ cswindows1258(2258),
+ csTIS620(2259),
+ reserved(3000)
+ }
+END
+
+5. IANA Considerations
+
+ IANA has assigned a base arc in the 'mgmt' (standards track) OID tree
+ for the 'ianaCharset' MODULE-IDENTITY defined in the IANA Charset MIB
+ [CHARMIB].
+
+ Whenever any 'charset' is added to the IANA Charset Registry
+ [CHARSET], a new version of the IANA Charset MIB [CHARMIB] may be
+ machine-generated using the C language utility [CHARGEN], described
+ in section 3 of this document or some other utility.
+
+6. Internationalization Considerations
+
+ The IANA Charset MIB [CHARMIB] defines the 'IANACharset' textual
+ convention that may be used in a given MIB module to supply explicit
+ character set labels for one or more text string objects defined in
+ that MIB module.
+
+ For example, the Printer MIB [RFC1759] defines the three character
+ set label objects 'prtLocalizationCharacterSet' (for description and
+ console strings), 'prtInterpreterDefaultCharSetIn' (for received
+
+
+
+
+McDonald Informational [Page 10]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ print job input data), and 'prtIntpreterDefaultCharSetOut' (for
+ processed print job output data).
+
+ The IANA Charset MIB [CHARMIB] supports implementation of the best
+ practices specified in "IETF Policy on Character Sets and Languages"
+ [RFC2277].
+
+ Note: The use of the 'SnmpAdminString' textual convention defined in
+ [RFC3411], which has a fixed character set of UTF-8 [RFC3629], is
+ STRONGLY RECOMMENDED in defining new MIB modules. The IANA Charset
+ MIB [CHARMIB] supports locale-specific MIB objects with variable
+ character sets.
+
+7. Security Considerations
+
+ This MIB module does not define any management objects. Instead, it
+ defines a (set of) textual convention(s) which may be used by other
+ MIB modules to define management objects.
+
+ Meaningful security considerations can only be written in the MIB
+ modules that define management objects. Therefore, this document has
+ no impact on the security of the Internet.
+
+8. Acknowledgements
+
+ The editor would like to thank: Bert Wijnen (Lucent) for his
+ original suggestion that the 'IANACharset' textual convention should
+ be extracted from Printer MIB v2 [RFC3805]; Ron Bergman (Hitachi
+ Printing Solutions) and Harry Lewis (IBM) for their many years of
+ effort as editors of Printer MIB v2 [RFC3805].
+
+9. References
+
+9.1. Normative References
+
+ [RFC2119] Bradner, S., "Key words for use in RFCs to Indicate
+ Requirement Levels", BCP 14, RFC 2119, March 1997.
+
+ [RFC2277] Alvestrand, H., "IETF Policy on Character Sets and
+ Languages", RFC 2277, January 1998.
+
+ [RFC2578] McCloghrie, K., Perkins, D., and J. Schoenwaelder,
+ "Structure of Management Information Version 2 (SMIv2)",
+ STD 58, RFC 2578, April 1999.
+
+ [RFC2579] McCloghrie, K., Perkins, D., and J. Schoenwaelder,
+ "Textual Conventions for SMIv2", STD 58, RFC 2579, April
+ 1999.
+
+
+
+McDonald Informational [Page 11]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+ [RFC2580] McCloghrie, K., Perkins, D., and J. Schoenwaelder,
+ "Conformance Statements for SMIv2", STD 58, RFC 2580,
+ April 1999.
+
+ [RFC2978] Freed, N. and J. Postel, "IANA Charset Registration
+ Procedures", BCP 19, RFC 2978, October 2000.
+
+ [RFC3411] Harrington, D., Presuhn, R., and B. Wijnen, "An
+ Architecture for Describing SNMP Network Management
+ Frameworks", STD 62, RFC 3411, December 2002.
+
+ [RFC3629] Yergeau, F., "UTF-8, a transformation format of ISO
+ 10646", RFC 3629, November 2003.
+
+9.2. Informative References
+
+ [CHARGEN] IANA Charset MIB Generation Utility (archived at):
+ ftp://www.pwg.org/pub/pwg/pmp/tools/ianachar.c
+
+ [CHARMIB] IANA Charset MIB (in the future, to be archived at):
+ http://www.iana.org/assignments/ianacharset-mib
+
+ [CHARSET] IANA Charset Registry (archived at):
+ http://www.iana.org/assignments/character-sets
+
+ [CHARTEMP] IANA Charset MIB template file (archived at):
+ ftp://www.pwg.org/pub/pwg/pmp/tools/ianachar.dat
+
+ [RFC1759] Smith, R., Wright, F., Hastings, T., Zilles, S., and J.
+ Gyllenskog. "Printer MIB", RFC 1759, March 1995.
+
+ [RFC3805] Bergman, R., Lewis, H., and I. McDonald, "Printer MIB
+ v2", RFC 3805, June 2004.
+
+ [RFC3410] Case, J., Mundy, P., Partain, D., and B. Stewart,
+ "Introduction and Applicability Statements for
+ Internet-Standard Network Management Framework", RFC
+ 3410, December 2002.
+
+
+
+
+
+
+
+
+
+
+
+
+
+McDonald Informational [Page 12]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+10. Authors' Addresses
+
+ Ira McDonald
+ High North Inc
+ 221 Ridge Ave
+ Grand Marais, MI 49839
+ USA
+
+ Phone: +1 906 494 2434
+ EMail: imcdonald@sharplabs.com
+
+
+ Internet Assigned Numbers Authority (IANA)
+ ICANN
+ 4676 Admiralty Way, Suite 330
+ Marina del Rey, CA 90292
+ USA
+
+ Phone: +1 310 823 9358
+ EMail: iana@iana.org
+
+ Note: Questions and comments on this IANA Charset MIB [CHARMIB]
+ should be sent to the editor (imcdonald@sharplabs.com) and IANA
+ (iana@iana.org) with a copy to the IETF Charsets mailing list
+ (ietf-charset@iana.org).
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+
+McDonald Informational [Page 13]
+
+RFC 3808 IANA Charset MIB June 2004
+
+
+11. Full Copyright Statement
+
+ Copyright (C) The Internet Society (2004). This document is subject
+ to the rights, licenses and restrictions contained in BCP 78, and
+ except as set forth therein, the authors retain all their rights.
+
+ This document and the information contained herein are provided on an
+ "AS IS" basis and THE CONTRIBUTOR, THE ORGANIZATION HE/SHE REPRESENTS
+ OR IS SPONSORED BY (IF ANY), THE INTERNET SOCIETY AND THE INTERNET
+ ENGINEERING TASK FORCE DISCLAIM ALL WARRANTIES, EXPRESS OR IMPLIED,
+ INCLUDING BUT NOT LIMITED TO ANY WARRANTY THAT THE USE OF THE
+ INFORMATION HEREIN WILL NOT INFRINGE ANY RIGHTS OR ANY IMPLIED
+ WARRANTIES OF MERCHANTABILITY OR FITNESS FOR A PARTICULAR PURPOSE.
+
+Intellectual Property
+
+ The IETF takes no position regarding the validity or scope of any
+ Intellectual Property Rights or other rights that might be claimed to
+ pertain to the implementation or use of the technology described in
+ this document or the extent to which any license under such rights
+ might or might not be available; nor does it represent that it has
+ made any independent effort to identify any such rights. Information
+ on the procedures with respect to rights in RFC documents can be
+ found in BCP 78 and BCP 79.
+
+ Copies of IPR disclosures made to the IETF Secretariat and any
+ assurances of licenses to be made available, or the result of an
+ attempt made to obtain a general license or permission for the use of
+ such proprietary rights by implementers or users of this
+ specification can be obtained from the IETF on-line IPR repository at
+ http://www.ietf.org/ipr.
+
+ The IETF invites any interested party to bring to its attention any
+ copyrights, patents or patent applications, or other proprietary
+ rights that may cover technology that may be required to implement
+ this standard. Please address the information to the IETF at ietf-
+ ipr@ietf.org.
+
+Acknowledgement
+
+ Funding for the RFC Editor function is currently provided by the
+ Internet Society.
+
+
+
+
+
+
+
+
+
+McDonald Informational [Page 14]
+